Products 143726-98-1
CAS 143726-98-1 is the registry number for 1,2-Difluoro-4-(trichloromethyl)benzene, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 5g, 25g, 1g.
1,2-difluoro-4-(trichloromethyl)benzene (CAS 143726-98-1) is a chemical compound with the molecular formula C7H3Cl3F2 and a molecular weight of 231.4 g/mol. IUPAC name: 1,2-difluoro-4-(trichloromethyl)benzene. InChIKey: KAVHKCGLLMKDAL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3F2 |
|---|---|
| Molecular weight | 231.4 g/mol |
| IUPAC name | 1,2-difluoro-4-(trichloromethyl)benzene |
| InChIKey | KAVHKCGLLMKDAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(Cl)(Cl)Cl)F)F |
Computed by PubChem (NCBI)