CAS 1437305-42-4 is the registry number for (9-(Dibenzo[b,d]furan-2-yl)-9H-carbazol-3-yl)diphenylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-dibenzofuran-2-yl-3-diphenylphosphorylcarbazole (CAS 1437305-42-4) is a chemical compound with the molecular formula C36H24NO2P and a molecular weight of 533.6 g/mol. IUPAC name: 9-dibenzofuran-2-yl-3-diphenylphosphorylcarbazole. InChIKey: XKEMQJBDCSICRN-UHFFFAOYSA-N.
| Molecular formula | C36H24NO2P |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | 9-dibenzofuran-2-yl-3-diphenylphosphorylcarbazole |
| InChIKey | XKEMQJBDCSICRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC4=C(C=C3)N(C5=CC=CC=C54)C6=CC7=C(C=C6)OC8=CC=CC=C87 |
Computed by PubChem (NCBI)