Products 1437311-91-5

CAS 1437311-91-5 is the registry number for Methyl 1-thia-4-azaspiro[4.4]nonane-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-thia-4-azaspiro[4.4]nonane-3-carboxylate;hydrochloride (CAS 1437311-91-5) is a chemical compound with the molecular formula C9H16ClNO2S and a molecular weight of 237.75 g/mol. IUPAC name: methyl 1-thia-4-azaspiro[4.4]nonane-3-carboxylate;hydrochloride. InChIKey: BDZSYUDCUZMBRV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO2S
Molecular weight237.75 g/mol
IUPAC namemethyl 1-thia-4-azaspiro[4.4]nonane-3-carboxylate;hydrochloride
InChIKeyBDZSYUDCUZMBRV-UHFFFAOYSA-N
SMILESCOC(=O)C1CSC2(N1)CCCC2.Cl

Computed by PubChem (NCBI)