Products 1437457-83-4
CAS 1437457-83-4 is the registry number for 4-Chloro-2-cyclohexylpyrido(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
4-chloro-2-cyclohexylpyrido[3,4-d]pyrimidine (CAS 1437457-83-4) is a chemical compound with the molecular formula C13H14ClN3 and a molecular weight of 247.72 g/mol. IUPAC name: 4-chloro-2-cyclohexylpyrido[3,4-d]pyrimidine. InChIKey: CSDLBNGMDFMGAE-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3 |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 4-chloro-2-cyclohexylpyrido[3,4-d]pyrimidine |
| InChIKey | CSDLBNGMDFMGAE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(C=CN=C3)C(=N2)Cl |
Computed by PubChem (NCBI)