CAS 143756-46-1 appears in our catalog under these names: IAANS (>80%), IAANS-d4. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg.
Sodium 6-[4-[(2-iodoacetyl)amino]anilino]naphthalene-2-sulfonate (CAS 143756-46-1) is a chemical compound with the molecular formula C18H14IN2NaO4S and a molecular weight of 504.3 g/mol. IUPAC name: sodium 6-[4-[(2-iodoacetyl)amino]anilino]naphthalene-2-sulfonate. InChIKey: XWDICRFLGKWTPK-UHFFFAOYSA-M.
| Molecular formula | C18H14IN2NaO4S |
|---|---|
| Molecular weight | 504.3 g/mol |
| IUPAC name | sodium 6-[4-[(2-iodoacetyl)amino]anilino]naphthalene-2-sulfonate |
| InChIKey | XWDICRFLGKWTPK-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1NC2=CC3=C(C=C2)C=C(C=C3)S(=O)(=O)[O-])NC(=O)CI.[Na+] |
Computed by PubChem (NCBI)