CAS 1437789-29-1 is the registry number for 1,1-Dimethylethyl 3-chloro-β-hydroxybenzenepropanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(3-chlorophenyl)-3-hydroxypropanoate (CAS 1437789-29-1) is a chemical compound with the molecular formula C13H17ClO3 and a molecular weight of 256.72 g/mol. IUPAC name: tert-butyl 3-(3-chlorophenyl)-3-hydroxypropanoate. InChIKey: FIYHCQVFAJPCSC-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO3 |
|---|---|
| Molecular weight | 256.72 g/mol |
| IUPAC name | tert-butyl 3-(3-chlorophenyl)-3-hydroxypropanoate |
| InChIKey | FIYHCQVFAJPCSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C1=CC(=CC=C1)Cl)O |
Computed by PubChem (NCBI)