CAS 1437794-77-8 is the registry number for 1-(Benzyloxy)-2-fluoro-3-(trifluoromethoxy)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-fluoro-1-phenylmethoxy-3-(trifluoromethoxy)benzene (CAS 1437794-77-8) is a chemical compound with the molecular formula C14H10F4O2 and a molecular weight of 286.22 g/mol. IUPAC name: 2-fluoro-1-phenylmethoxy-3-(trifluoromethoxy)benzene. InChIKey: DVWRMVDRLLNETP-UHFFFAOYSA-N.
| Molecular formula | C14H10F4O2 |
|---|---|
| Molecular weight | 286.22 g/mol |
| IUPAC name | 2-fluoro-1-phenylmethoxy-3-(trifluoromethoxy)benzene |
| InChIKey | DVWRMVDRLLNETP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC=C2)OC(F)(F)F)F |
Computed by PubChem (NCBI)