CAS 143782-63-2 is the registry number for RU 58642. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-(cyanomethyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (CAS 143782-63-2) is a chemical compound with the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. IUPAC name: 4-[3-(cyanomethyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile. InChIKey: ZVWXHSNUBLIKJH-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N4O2 |
|---|---|
| Molecular weight | 336.27 g/mol |
| IUPAC name | 4-[3-(cyanomethyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | ZVWXHSNUBLIKJH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CC#N)C2=CC(=C(C=C2)C#N)C(F)(F)F)C |
Computed by PubChem (NCBI)