CAS 143797-62-0 appears in our catalog under these names: Sb 200646 hydrochloride, 95%, SB 200646 hydrochloride, SB-200646A, SB-200646A, ≥96%, ≥96%, SB-200646A, 99.14%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 2mg, 25mg, 5mg, 250mg, 10mM/1mL.
1-(1-methylindol-5-yl)-3-pyridin-3-ylurea;hydrochloride (CAS 143797-62-0) is a chemical compound with the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. IUPAC name: 1-(1-methylindol-5-yl)-3-pyridin-3-ylurea;hydrochloride. InChIKey: IGRYPUQJEDJLHC-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN4O |
|---|---|
| Molecular weight | 302.76 g/mol |
| IUPAC name | 1-(1-methylindol-5-yl)-3-pyridin-3-ylurea;hydrochloride |
| InChIKey | IGRYPUQJEDJLHC-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)NC(=O)NC3=CN=CC=C3.Cl |
Computed by PubChem (NCBI)