Products 1438-57-9
CAS 1438-57-9 appears in our catalog under these names: (-)-Grindelic acid, Grindelic acid, >=95% (LC/MS-ELSD), Grindelic acid. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 1MG.
2-[(2'S,4aS,8R,8aS)-2',4,4,7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid (CAS 1438-57-9) is a chemical compound with the molecular formula C20H32O3 and a molecular weight of 320.5 g/mol. IUPAC name: 2-[(2'S,4aS,8R,8aS)-2',4,4,7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid. InChIKey: XLWWERNKTLITEF-MVJPYGJCSA-N.
| Molecular formula | C20H32O3 |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | 2-[(2'S,4aS,8R,8aS)-2',4,4,7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid |
| InChIKey | XLWWERNKTLITEF-MVJPYGJCSA-N |
| SMILES | CC1=CC[C@@H]2[C@@]([C@@]13CC[C@@](O3)(C)CC(=O)O)(CCCC2(C)C)C |
Computed by PubChem (NCBI)