Products 1438527-99-1

CAS 1438527-99-1 is the registry number for Methadone Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,1,2-trimethylaziridin-1-ium chloride (CAS 1438527-99-1) is a chemical compound with the molecular formula C5H12ClN and a molecular weight of 121.61 g/mol. IUPAC name: 1,1,2-trimethylaziridin-1-ium chloride. InChIKey: WBJOBEUTDUZLNH-UHFFFAOYSA-M.

Identity
Molecular formulaC5H12ClN
Molecular weight121.61 g/mol
IUPAC name1,1,2-trimethylaziridin-1-ium chloride
InChIKeyWBJOBEUTDUZLNH-UHFFFAOYSA-M
SMILESCC1C[N+]1(C)C.[Cl-]

Computed by PubChem (NCBI)