CAS 1438853-57-6 is the registry number for Des-(N-(4-chloro-2-methyl-6(((methylamino)carboyl))phenyl)) Chlorantraniliprole, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide (CAS 1438853-57-6) is a chemical compound with the molecular formula C9H6BrClN4O and a molecular weight of 301.53 g/mol. IUPAC name: 3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide. InChIKey: ALGLHCFROQVWRL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN4O |
|---|---|
| Molecular weight | 301.53 g/mol |
| IUPAC name | 3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide |
| InChIKey | ALGLHCFROQVWRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C(=CC(=N2)Br)C(=O)N)Cl |
Computed by PubChem (NCBI)