CAS 1439319-94-4 appears in our catalog under these names: (2R,5S)-4-(tert-butoxycarbonyl)-5-MethylMorpholine-2-carboxylic acid, 97%, 97%, (2R,5S)-4-(tert-butoxycarbonyl)-5-methylmorpholine-2-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 1439319-94-4) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: MTVXSGMUDRWQHZ-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | MTVXSGMUDRWQHZ-JGVFFNPUSA-N |
| SMILES | C[C@H]1CO[C@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)