Products 1439373-14-4
CAS 1439373-14-4 appears in our catalog under these names: (S)-tert-Butyl 2-(fluoromethyl)morpholine-4-carboxylate, 95%, (2S)-2-(Fluoromethyl)-4-morpholinecarboxylic acid 1,1-dimethylethyl ester, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl (2S)-2-(fluoromethyl)morpholine-4-carboxylate (CAS 1439373-14-4) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (2S)-2-(fluoromethyl)morpholine-4-carboxylate. InChIKey: PIXDCZBIKFLQHG-MRVPVSSYSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (2S)-2-(fluoromethyl)morpholine-4-carboxylate |
| InChIKey | PIXDCZBIKFLQHG-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)CF |
Computed by PubChem (NCBI)