CAS 14394-26-4 is the registry number for Dimephosphon. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-dimethoxyphosphoryl-4-methylpentan-2-one (CAS 14394-26-4) is a chemical compound with the molecular formula C8H17O4P and a molecular weight of 208.19 g/mol. IUPAC name: 4-dimethoxyphosphoryl-4-methylpentan-2-one. InChIKey: MOMJYWJXUNIBGJ-UHFFFAOYSA-N.
| Molecular formula | C8H17O4P |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 4-dimethoxyphosphoryl-4-methylpentan-2-one |
| InChIKey | MOMJYWJXUNIBGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)P(=O)(OC)OC |
Computed by PubChem (NCBI)