CAS 143965-99-5 is the registry number for MFZ 2-12. Offered by: TRC, Biosynth. Available pack sizes: 50mg.
Methyl (1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 143965-99-5) is a chemical compound with the molecular formula C16H19Cl2NO2 and a molecular weight of 328.2 g/mol. IUPAC name: methyl (1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: AMIHUYQKNJHXPT-DRABBMOASA-N.
| Molecular formula | C16H19Cl2NO2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | methyl (1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | AMIHUYQKNJHXPT-DRABBMOASA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC(=C(C=C3)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)