CAS 14397-53-6 is the registry number for N,N,N',N'-Tetraisopropylethanediamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N,N,N',N'-tetra(propan-2-yl)oxamide (CAS 14397-53-6) is a chemical compound with the molecular formula C14H28N2O2 and a molecular weight of 256.38 g/mol. IUPAC name: N,N,N',N'-tetra(propan-2-yl)oxamide. InChIKey: WBOXXAGOYCERQA-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O2 |
|---|---|
| Molecular weight | 256.38 g/mol |
| IUPAC name | N,N,N',N'-tetra(propan-2-yl)oxamide |
| InChIKey | WBOXXAGOYCERQA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C(=O)N(C(C)C)C(C)C |
Computed by PubChem (NCBI)