CAS 14397-69-4 is the registry number for Jaceidin triacetate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(5,7-diacetyloxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate (CAS 14397-69-4) is a chemical compound with the molecular formula C24H22O11 and a molecular weight of 486.4 g/mol. IUPAC name: [4-(5,7-diacetyloxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate. InChIKey: DGHDHYGZDLRGBT-UHFFFAOYSA-N.
| Molecular formula | C24H22O11 |
|---|---|
| Molecular weight | 486.4 g/mol |
| IUPAC name | [4-(5,7-diacetyloxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate |
| InChIKey | DGHDHYGZDLRGBT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC(=O)C)OC)OC(=O)C)OC)OC |
Computed by PubChem (NCBI)