CAS 14398-36-8 appears in our catalog under these names: R-Beta-Ionone, R-b-Ionone. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-one (CAS 14398-36-8) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: (E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-one. InChIKey: UZFLPKAIBPNNCA-ABZNLYFFSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | (E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-one |
| InChIKey | UZFLPKAIBPNNCA-ABZNLYFFSA-N |
| SMILES | CC1=CCCC([C@@H]1/C=C/C(=O)C)(C)C |
Computed by PubChem (NCBI)