CAS 1439896-19-1 is the registry number for 10-Chlorocamphor, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(1S)-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one (CAS 1439896-19-1) is a chemical compound with the molecular formula C10H15ClO and a molecular weight of 186.68 g/mol. IUPAC name: (1S)-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one. InChIKey: PKTBHNPYHOMBAI-OMNKOJBGSA-N.
| Molecular formula | C10H15ClO |
|---|---|
| Molecular weight | 186.68 g/mol |
| IUPAC name | (1S)-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | PKTBHNPYHOMBAI-OMNKOJBGSA-N |
| SMILES | CC1(C2CC[C@]1(C(=O)C2)CCl)C |
Computed by PubChem (NCBI)