CAS 1439897-98-9 is the registry number for 3-(4-Fluorophenyl)-2,2-dimethylpropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride (CAS 1439897-98-9) is a chemical compound with the molecular formula C11H17ClFN and a molecular weight of 217.71 g/mol. IUPAC name: 3-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride. InChIKey: NPTNBLCYZNZRJL-UHFFFAOYSA-N.
| Molecular formula | C11H17ClFN |
|---|---|
| Molecular weight | 217.71 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
| InChIKey | NPTNBLCYZNZRJL-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)F)CN.Cl |
Computed by PubChem (NCBI)