CAS 1439899-25-8 is the registry number for [3-(4-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine;hydrochloride (CAS 1439899-25-8) is a chemical compound with the molecular formula C13H12ClFN4 and a molecular weight of 278.71 g/mol. IUPAC name: [3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine;hydrochloride. InChIKey: OUOKXLNTVADTOB-UHFFFAOYSA-N.
| Molecular formula | C13H12ClFN4 |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | [3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine;hydrochloride |
| InChIKey | OUOKXLNTVADTOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C3N2C=C(C=C3)CN)F.Cl |
Computed by PubChem (NCBI)