CAS 144-02-5 appears in our catalog under these names: Sodium Barbital (1mg/ml in Acetonitrile), Barbital Sodium, Sodium Barbital, >95% (HPLC), Sodium 5,5-diethylbarbiturate, 5,5-DIETHYLBARBITURIC ACID SODIUM SALT. Offered by: TRC, Mikromol, LoGiCal, Sigma-Aldrich. Available pack sizes: 1x1ml, 100mg, 10mg, 500mg, 500G, 100G.
Sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate (CAS 144-02-5) is a chemical compound with the molecular formula C8H11N2NaO3 and a molecular weight of 206.17 g/mol. IUPAC name: sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate. InChIKey: RGHFKWPGWBFQLN-UHFFFAOYSA-M.
| Molecular formula | C8H11N2NaO3 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate |
| InChIKey | RGHFKWPGWBFQLN-UHFFFAOYSA-M |
| SMILES | CCC1(C(=O)NC(=NC1=O)[O-])CC.[Na+] |
Computed by PubChem (NCBI)