CAS 144-87-6 is the registry number for Astryl, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 2mg.
[4-[(2-hydroxyacetyl)amino]phenyl]arsonic acid (CAS 144-87-6) is a chemical compound with the molecular formula C8H10AsNO5 and a molecular weight of 275.09 g/mol. IUPAC name: [4-[(2-hydroxyacetyl)amino]phenyl]arsonic acid. InChIKey: QABXFDAPQQVMKL-UHFFFAOYSA-N.
| Molecular formula | C8H10AsNO5 |
|---|---|
| Molecular weight | 275.09 g/mol |
| IUPAC name | [4-[(2-hydroxyacetyl)amino]phenyl]arsonic acid |
| InChIKey | QABXFDAPQQVMKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CO)[As](=O)(O)O |
Computed by PubChem (NCBI)