CAS 14401-07-1 appears in our catalog under these names: N-(2,4-Dinitrophenyl)-DL-threonine, >98.0%(HPLC), Threonine, N-(2,4-dinitrophenyl)-, ≥97%, ≥97%, Threonine, N-(2,4-dinitrophenyl)-, ≥97%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(2,4-dinitroanilino)-3-hydroxybutanoic acid (CAS 14401-07-1) is a chemical compound with the molecular formula C10H11N3O7 and a molecular weight of 285.21 g/mol. IUPAC name: 2-(2,4-dinitroanilino)-3-hydroxybutanoic acid. InChIKey: PWOCOTZWYFGDMO-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O7 |
|---|---|
| Molecular weight | 285.21 g/mol |
| IUPAC name | 2-(2,4-dinitroanilino)-3-hydroxybutanoic acid |
| InChIKey | PWOCOTZWYFGDMO-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)O)NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])O |
Computed by PubChem (NCBI)