CAS 144017-74-3 is the registry number for (E)-1-Phenyl-3-(4-(trifluoromethyl)phenyl)prop-2-en-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
(E)-1-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (CAS 144017-74-3) is a chemical compound with the molecular formula C16H11F3O and a molecular weight of 276.25 g/mol. IUPAC name: (E)-1-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one. InChIKey: QZMAQARJRMCAPU-DHZHZOJOSA-N.
| Molecular formula | C16H11F3O |
|---|---|
| Molecular weight | 276.25 g/mol |
| IUPAC name | (E)-1-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| InChIKey | QZMAQARJRMCAPU-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)