CAS 1440512-67-3 is the registry number for 4,6-Dichloro-2-(benzylthio)-5-pyrimidineamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-benzylsulfanyl-4,6-dichloropyrimidin-5-amine (CAS 1440512-67-3) is a chemical compound with the molecular formula C11H9Cl2N3S and a molecular weight of 286.2 g/mol. IUPAC name: 2-benzylsulfanyl-4,6-dichloropyrimidin-5-amine. InChIKey: SVNIYLGANBOUOG-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3S |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 2-benzylsulfanyl-4,6-dichloropyrimidin-5-amine |
| InChIKey | SVNIYLGANBOUOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC(=C(C(=N2)Cl)N)Cl |
Computed by PubChem (NCBI)