CAS 1440526-56-6 is the registry number for 6-Benzyloxy-2-bromo-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-6-phenylmethoxy-1,3-benzothiazole (CAS 1440526-56-6) is a chemical compound with the molecular formula C14H10BrNOS and a molecular weight of 320.21 g/mol. IUPAC name: 2-bromo-6-phenylmethoxy-1,3-benzothiazole. InChIKey: NFKUIKBAAWOPMW-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNOS |
|---|---|
| Molecular weight | 320.21 g/mol |
| IUPAC name | 2-bromo-6-phenylmethoxy-1,3-benzothiazole |
| InChIKey | NFKUIKBAAWOPMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)N=C(S3)Br |
Computed by PubChem (NCBI)