CAS 1440531-58-7 is the registry number for Lithium methyltriolborate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Lithium 1,4-dimethyl-3,5,8-trioxa-1-boranuidabicyclo[2.2.2]octane (CAS 1440531-58-7) is a chemical compound with the molecular formula C6H12BLiO3 and a molecular weight of 149.9 g/mol. IUPAC name: lithium 1,4-dimethyl-3,5,8-trioxa-1-boranuidabicyclo[2.2.2]octane. InChIKey: XBNPRRSOUJZBJY-UHFFFAOYSA-N.
| Molecular formula | C6H12BLiO3 |
|---|---|
| Molecular weight | 149.9 g/mol |
| IUPAC name | lithium 1,4-dimethyl-3,5,8-trioxa-1-boranuidabicyclo[2.2.2]octane |
| InChIKey | XBNPRRSOUJZBJY-UHFFFAOYSA-N |
| SMILES | [Li+].[B-]12(COC(OC1)(OC2)C)C |
Computed by PubChem (NCBI)