CAS 1440535-45-4 appears in our catalog under these names: 2-(Benzylamino)-2-(3,4-dichlorophenyl)acetonitrile hydrochloride, 98%, 98%, 2-(Benzylamino)-2-(3,4-dichlorophenyl)acetonitrile hydrochloride, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(benzylamino)-2-(3,4-dichlorophenyl)acetonitrile;hydrochloride (CAS 1440535-45-4) is a chemical compound with the molecular formula C15H13Cl3N2 and a molecular weight of 327.6 g/mol. IUPAC name: 2-(benzylamino)-2-(3,4-dichlorophenyl)acetonitrile;hydrochloride. InChIKey: PZVODKSALPKDNK-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl3N2 |
|---|---|
| Molecular weight | 327.6 g/mol |
| IUPAC name | 2-(benzylamino)-2-(3,4-dichlorophenyl)acetonitrile;hydrochloride |
| InChIKey | PZVODKSALPKDNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(C#N)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)