Products 144084-35-5
CAS 144084-35-5 is the registry number for N-t-Butyl-2-methoxynicotinamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-tert-butyl-2-methoxypyridine-3-carboxamide (CAS 144084-35-5) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: N-tert-butyl-2-methoxypyridine-3-carboxamide. InChIKey: KEOPBHKTPCLLJC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-tert-butyl-2-methoxypyridine-3-carboxamide |
| InChIKey | KEOPBHKTPCLLJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(N=CC=C1)OC |
Computed by PubChem (NCBI)