CAS 1440950-65-1 is the registry number for Levocarnitine Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-4-(trimethylazaniumyl)but-2-enoate (CAS 1440950-65-1) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (Z)-4-(trimethylazaniumyl)but-2-enoate. InChIKey: GUYHPGUANSLONG-PLNGDYQASA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (Z)-4-(trimethylazaniumyl)but-2-enoate |
| InChIKey | GUYHPGUANSLONG-PLNGDYQASA-N |
| SMILES | C[N+](C)(C)C/C=C\C(=O)[O-] |
Computed by PubChem (NCBI)