Products 1440965-36-5
CAS 1440965-36-5 appears in our catalog under these names: N–(5–fluoro–4–iodo–2–methylphenyl)acetamide, N-(5-fluoro-4-iodo-2-methylphenyl)acetamide. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 5g.
N-(5-fluoro-4-iodo-2-methylphenyl)acetamide (CAS 1440965-36-5) is a chemical compound with the molecular formula C9H9FINO and a molecular weight of 293.08 g/mol. IUPAC name: N-(5-fluoro-4-iodo-2-methylphenyl)acetamide. InChIKey: IVCNUUVUKIQUDM-UHFFFAOYSA-N.
| Molecular formula | C9H9FINO |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | N-(5-fluoro-4-iodo-2-methylphenyl)acetamide |
| InChIKey | IVCNUUVUKIQUDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C)F)I |
Computed by PubChem (NCBI)