Products 144120-51-4
CAS 144120-51-4 appears in our catalog under these names: Methylcyclopentane-d12, 98 atom % D, min 98% Chemical Purity, Methylcyclopentane-d12. Offered by: CDN, Biosynth. Available pack sizes: 1g, 0,5g.
1,1,2,2,3,3,4,4,5-nonadeuterio-5-(trideuteriomethyl)cyclopentane (CAS 144120-51-4) is a chemical compound with the molecular formula C6H12 and a molecular weight of 96.23 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5-nonadeuterio-5-(trideuteriomethyl)cyclopentane. InChIKey: GDOPTJXRTPNYNR-PSDCQUMKSA-N.
| Molecular formula | C6H12 |
|---|---|
| Molecular weight | 96.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5-nonadeuterio-5-(trideuteriomethyl)cyclopentane |
| InChIKey | GDOPTJXRTPNYNR-PSDCQUMKSA-N |
| SMILES | [2H]C1(C(C(C(C1([2H])[2H])([2H])C([2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)