CAS 144155-85-1 is the registry number for 5,8-Dichloro-1H-benzo(d)(1,3)oxazine-2,4-dione, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5,8-dichloro-1H-3,1-benzoxazine-2,4-dione (CAS 144155-85-1) is a chemical compound with the molecular formula C8H3Cl2NO3 and a molecular weight of 232.02 g/mol. IUPAC name: 5,8-dichloro-1H-3,1-benzoxazine-2,4-dione. InChIKey: CTMWWMXXWKUCKR-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO3 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 5,8-dichloro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | CTMWWMXXWKUCKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=O)OC(=O)N2)Cl |
Computed by PubChem (NCBI)