Products 1442400-65-8
CAS 1442400-65-8 appears in our catalog under these names: Azilsartan Impurity 36, Azilsartan Impurity M, Azilsartan Impurity 1, 1-((2'-(Aminoiminomethyl)(1,1'-biphenyl)-4-yl)methyl)-2-ethoxy-1H-benzimidazole-7-carboxylic Acid, Azilsartan impurity 27. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 200mg, Get quote.
3-[[4-(2-carbamimidoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid (CAS 1442400-65-8) is a chemical compound with the molecular formula C24H22N4O3 and a molecular weight of 414.5 g/mol. IUPAC name: 3-[[4-(2-carbamimidoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid. InChIKey: GLEVNSRDOQPXLD-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O3 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 3-[[4-(2-carbamimidoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid |
| InChIKey | GLEVNSRDOQPXLD-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=N)N)C(=O)O |
Computed by PubChem (NCBI)