CAS 1442433-71-7 appears in our catalog under these names: 9-Mesityl-10-methylacridinium tetrafluoroborate, 97%, 9-Mesityl-10-methylacridinium Tetrafluoroborate, 9-Mesityl-10-methylacridin-10-ium tetrafluoroborate 97%, 9-MESITYL-10-METHYLACRIDINIUM TETRAFLUO&, 9-Mesityl-10-methylacridin-10-ium tetrafluoroborate, 97%, 97%. Offered by: Combi-blocks, TRC, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 500mg, 5g, 25g, 50g.
10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate (CAS 1442433-71-7) is a chemical compound with the molecular formula C23H22BF4N and a molecular weight of 399.2 g/mol. IUPAC name: 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate. InChIKey: KKMWMXQQOIIJIZ-UHFFFAOYSA-N.
| Molecular formula | C23H22BF4N |
|---|---|
| Molecular weight | 399.2 g/mol |
| IUPAC name | 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
| InChIKey | KKMWMXQQOIIJIZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C)C |
Computed by PubChem (NCBI)