CAS 144293-91-4 is the registry number for N'-(2,4-Dichlorobenzylidene)isonicotinohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-4-carboxamide (CAS 144293-91-4) is a chemical compound with the molecular formula C13H9Cl2N3O and a molecular weight of 294.13 g/mol. IUPAC name: N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-4-carboxamide. InChIKey: MCYZXLQRWHJGIT-CAOOACKPSA-N.
| Molecular formula | C13H9Cl2N3O |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-4-carboxamide |
| InChIKey | MCYZXLQRWHJGIT-CAOOACKPSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=N/NC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)