CAS 144301-37-1 is the registry number for GPI-3000. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-amino-3-[(1R,2S)-2-(2-phosphonoethyl)cyclohexyl]propanoic acid (CAS 144301-37-1) is a chemical compound with the molecular formula C11H22NO5P and a molecular weight of 279.27 g/mol. IUPAC name: (2R)-2-amino-3-[(1R,2S)-2-(2-phosphonoethyl)cyclohexyl]propanoic acid. InChIKey: DHJQWBSZKBDBFP-IVZWLZJFSA-N.
| Molecular formula | C11H22NO5P |
|---|---|
| Molecular weight | 279.27 g/mol |
| IUPAC name | (2R)-2-amino-3-[(1R,2S)-2-(2-phosphonoethyl)cyclohexyl]propanoic acid |
| InChIKey | DHJQWBSZKBDBFP-IVZWLZJFSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)CCP(=O)(O)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)