CAS 144317-19-1 appears in our catalog under these names: Z–Gln(Mtt)–OH, Z-Gln(Mtt)-OH. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
(2S)-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 144317-19-1) is a chemical compound with the molecular formula C33H32N2O5 and a molecular weight of 536.6 g/mol. IUPAC name: (2S)-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: FPSOCLFFNPGXTD-LJAQVGFWSA-N.
| Molecular formula | C33H32N2O5 |
|---|---|
| Molecular weight | 536.6 g/mol |
| IUPAC name | (2S)-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | FPSOCLFFNPGXTD-LJAQVGFWSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@@H](C(=O)O)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)