CAS 1443329-91-6 is the registry number for 2-(3,5-Dichlorophenyl)propanedioyl Dichloride. Offered by: TRC. Available pack sizes: 250mg.
2-(3,5-dichlorophenyl)propanedioyl dichloride (CAS 1443329-91-6) is a chemical compound with the molecular formula C9H4Cl4O2 and a molecular weight of 285.9 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)propanedioyl dichloride. InChIKey: YWUIQYVBRLYLBI-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl4O2 |
|---|---|
| Molecular weight | 285.9 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)propanedioyl dichloride |
| InChIKey | YWUIQYVBRLYLBI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)