CAS 1443437-74-8 appears in our catalog under these names: Ccg-203971, 95%, CCG 203971, CCG-203971/ 99.35% (existing batch purity), CCG 203971, CCG-203971 97%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 500mg, 1mg.
N-(4-chlorophenyl)-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide (CAS 1443437-74-8) is a chemical compound with the molecular formula C23H21ClN2O3 and a molecular weight of 408.9 g/mol. IUPAC name: N-(4-chlorophenyl)-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide. InChIKey: HERLZBNILRVHQN-UHFFFAOYSA-N.
| Molecular formula | C23H21ClN2O3 |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | N-(4-chlorophenyl)-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide |
| InChIKey | HERLZBNILRVHQN-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC=CC(=C2)C3=CC=CO3)C(=O)NC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)