CAS 1443981-40-5 appears in our catalog under these names: Sodium 4-(methylcarbamoyl)butanoate, 95%, Sodium 4-(methylcarbamoyl)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Sodium 5-(methylamino)-5-oxopentanoate (CAS 1443981-40-5) is a chemical compound with the molecular formula C6H10NNaO3 and a molecular weight of 167.14 g/mol. IUPAC name: sodium 5-(methylamino)-5-oxopentanoate. InChIKey: PFHOBHLFRQZURX-UHFFFAOYSA-M.
| Molecular formula | C6H10NNaO3 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | sodium 5-(methylamino)-5-oxopentanoate |
| InChIKey | PFHOBHLFRQZURX-UHFFFAOYSA-M |
| SMILES | CNC(=O)CCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)