CAS 144407-18-1 is the registry number for Vitamin A EP Impurity B (Anhydro-Vitamin A). Offered by: Chemat Brand. Available pack sizes: on request.
(6Z)-6-[(2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraenylidene]-1,5,5-trimethylcyclohexene (CAS 144407-18-1) is a chemical compound with the molecular formula C20H28 and a molecular weight of 268.4 g/mol. IUPAC name: (6Z)-6-[(2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraenylidene]-1,5,5-trimethylcyclohexene. InChIKey: FWNRILWHNGFAIN-SSHGZYQJSA-N.
| Molecular formula | C20H28 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (6Z)-6-[(2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraenylidene]-1,5,5-trimethylcyclohexene |
| InChIKey | FWNRILWHNGFAIN-SSHGZYQJSA-N |
| SMILES | CC\1=CCCC(/C1=C/C=C(\C)/C=C/C=C(\C)/C=C)(C)C |
Computed by PubChem (NCBI)