CAS 144425-86-5 is the registry number for BW-1003C87 (Ethylsulfate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethanesulfonic acid;5-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine (CAS 144425-86-5) is a chemical compound with the molecular formula C12H13Cl3N4O3S and a molecular weight of 399.7 g/mol. IUPAC name: ethanesulfonic acid;5-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine. InChIKey: NVKJAOGJEDODFZ-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl3N4O3S |
|---|---|
| Molecular weight | 399.7 g/mol |
| IUPAC name | ethanesulfonic acid;5-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine |
| InChIKey | NVKJAOGJEDODFZ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)O.C1=C(C=C(C(=C1C2=CN=C(N=C2N)N)Cl)Cl)Cl |
Computed by PubChem (NCBI)