CAS 14443-37-9 appears in our catalog under these names: 6,8-Dihydroxy-2-methylmercaptopurine, 95%, 2-(Methylthio)-7H-purine-6,8-diol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2-methylsulfanyl-7,9-dihydro-1H-purine-6,8-dione (CAS 14443-37-9) is a chemical compound with the molecular formula C6H6N4O2S and a molecular weight of 198.21 g/mol. IUPAC name: 2-methylsulfanyl-7,9-dihydro-1H-purine-6,8-dione. InChIKey: ABNKHLJAVYVWBF-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2S |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 2-methylsulfanyl-7,9-dihydro-1H-purine-6,8-dione |
| InChIKey | ABNKHLJAVYVWBF-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=O)N1)NC(=O)N2 |
Computed by PubChem (NCBI)