CAS 144435-10-9 is the registry number for 6,7-Dinitro-1H,4H-pyrido[2,3-b]pyrazine-2,3-dione, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (CAS 144435-10-9) is a chemical compound with the molecular formula C7H3N5O6 and a molecular weight of 253.13 g/mol. IUPAC name: 6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione. InChIKey: GDBMNBXUUXVCIS-UHFFFAOYSA-N.
| Molecular formula | C7H3N5O6 |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | GDBMNBXUUXVCIS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1[N+](=O)[O-])[N+](=O)[O-])NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)