Products 1444382-92-6
CAS 1444382-92-6 is the registry number for BPIC. Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzyl 1-(4-hydroxy-3-methoxycarbonylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate (CAS 1444382-92-6) is a chemical compound with the molecular formula C27H20N2O5 and a molecular weight of 452.5 g/mol. IUPAC name: benzyl 1-(4-hydroxy-3-methoxycarbonylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: QTOJFNFWYFXKQT-UHFFFAOYSA-N.
| Molecular formula | C27H20N2O5 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | benzyl 1-(4-hydroxy-3-methoxycarbonylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | QTOJFNFWYFXKQT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=C3C(=CC(=N2)C(=O)OCC4=CC=CC=C4)C5=CC=CC=C5N3)O |
Computed by PubChem (NCBI)
Synonyms:
BPIC, orb1703665