CAS 14444-53-2 is the registry number for Bis[o-(N-ethylformimidoyl)phenolato]palladium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2-(ethyliminomethyl)phenolate);palladium(2+) (CAS 14444-53-2) is a chemical compound with the molecular formula C18H20N2O2Pd and a molecular weight of 402.8 g/mol. IUPAC name: bis(2-(ethyliminomethyl)phenolate);palladium(2+). InChIKey: XECFUGYSFUBCPU-UHFFFAOYSA-L.
| Molecular formula | C18H20N2O2Pd |
|---|---|
| Molecular weight | 402.8 g/mol |
| IUPAC name | bis(2-(ethyliminomethyl)phenolate);palladium(2+) |
| InChIKey | XECFUGYSFUBCPU-UHFFFAOYSA-L |
| SMILES | CCN=CC1=CC=CC=C1[O-].CCN=CC1=CC=CC=C1[O-].[Pd+2] |
Computed by PubChem (NCBI)