Products 14446-75-4
CAS 14446-75-4 appears in our catalog under these names: Cis-3,5-dimethylpiperidine, 98%, cis-3,5-Dimethylpiperidine, >95% (GC), cis–3，5–Dimethylpiperidine, (3R,5S)-rel-3,5-Dimethylpiperidine 98%, cis-3,5-Dimethylpiperidine, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 100mg, 500mg, 50mg.
(3S,5R)-3,5-dimethylpiperidine (CAS 14446-75-4) is a chemical compound with the molecular formula C7H15N and a molecular weight of 113.20 g/mol. IUPAC name: (3S,5R)-3,5-dimethylpiperidine. InChIKey: IDWRJRPUIXRFRX-KNVOCYPGSA-N.
| Molecular formula | C7H15N |
|---|---|
| Molecular weight | 113.20 g/mol |
| IUPAC name | (3S,5R)-3,5-dimethylpiperidine |
| InChIKey | IDWRJRPUIXRFRX-KNVOCYPGSA-N |
| SMILES | C[C@@H]1C[C@@H](CNC1)C |
Computed by PubChem (NCBI)
Synonyms:
rel-(3R,5S)-3,5-dimethylpiperidine, piperidine, 3,5-dimethyl-, (3R,5S)-, InChI=1/C7H15N/c1-6-3-7(2)5-8-4-6/h6-8H,3-5H2,1-2H3/t6-,7, cis-3,5-Dimethylpiperidine, (3R,5S)-3,5-dimethylpiperidine, cis-3,5-Dimethyl-piperidine, Piperidine, 3,5-dimethyl-, (3R,5S)-rel-, (3R,5S)-rel-3,5-Dimethylpiperidine, 3,5-cis-dimethylpiperidine, cis-35-Dimethylpiperidine